C13H17ClF2N2O3 — CID 75505419
3-[4-chloro-3-(difluoromethoxy)phenyl]-1-(2-hydroxyethyl)-1-propan-2-ylurea (PubChem CID 75505419) has the molecular formula C13H17ClF2N2O3 and a molecular weight of 322.74 g/mol. Its IUPAC name is 3-[4-chloro-3-(difluoromethoxy)phenyl]-1-(2-hydroxyethyl)-1-propan-2-ylurea.
| Compound Name | 3-[4-chloro-3-(difluoromethoxy)phenyl]-1-(2-hydroxyethyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 75505419 |
| Molecular Formula | C13H17ClF2N2O3 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-[4-chloro-3-(difluoromethoxy)phenyl]-1-(2-hydroxyethyl)-1-propan-2-ylurea |
| SMILES | CC(C)N(CCO)C(=O)Nc1ccc(Cl)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H17ClF2N2O3/c1-8(2)18(5-6-19)13(20)17-9-3-4-10(14)11(7-9)21-12(15)16/h3-4,7-8,12,19H,5-6H2,1-2H3,(H,17,20) |
| InChIKey | QQEAWPXXMHENEU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |