C16H24F2N2O3 — CID 109388786
1-[4-(difluoromethoxy)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea (PubChem CID 109388786) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
|---|---|
| PubChem CID | 109388786 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-hydroxy-2,2,4-trimethylpentyl)urea |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H24F2N2O3/c1-10(2)13(21)16(3,4)9-19-15(22)20-11-5-7-12(8-6-11)23-14(17)18/h5-8,10,13-14,21H,9H2,1-4H3,(H2,19,20,22) |
| InChIKey | POFHMQNTCHMSLN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |