C19H17ClN2O4S — CID 27006763
N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 27006763) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 27006763 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(OCc3cscn3)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O4S/c1-24-17-8-16(18(25-2)7-15(17)20)22-19(23)12-4-3-5-14(6-12)26-9-13-10-27-11-21-13/h3-8,10-11H,9H2,1-2H3,(H,22,23) |
| InChIKey | QYJQXLHJXZXSFV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |