C19H20O4 — CID 7776976
[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 4-hydroxybenzoate (PubChem CID 7776976) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 7776976 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 4-hydroxybenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(O)cc2)c(C)c(C)c1C |
| InChI | InChI=1S/C19H20O4/c1-11-9-17(14(4)13(3)12(11)2)18(21)10-23-19(22)15-5-7-16(20)8-6-15/h5-9,20H,10H2,1-4H3 |
| InChIKey | GQKODVXNRWMWQI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |