C23H20N2O6S2 — CID 16958625
[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate (PubChem CID 16958625) has the molecular formula C23H20N2O6S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate.
| Compound Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 16958625 |
| Molecular Formula | C23H20N2O6S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC(C)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N2O6S2/c1-14(19-8-5-11-33-19)24-21(26)13-31-23(28)17-7-4-3-6-16(17)22(27)15-9-10-20(32-2)18(12-15)25(29)30/h3-12,14H,13H2,1-2H3,(H,24,26) |
| InChIKey | ZMBUFGBBQJJOMT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|