C24H21N3O5S2 — CID 32905063
(4-methylsulfanyl-3-nitrophenyl)-[2-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]phenyl]methanone (PubChem CID 32905063) has the molecular formula C24H21N3O5S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is (4-methylsulfanyl-3-nitrophenyl)-[2-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]phenyl]methanone.
| Compound Name | (4-methylsulfanyl-3-nitrophenyl)-[2-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]phenyl]methanone |
|---|---|
| PubChem CID | 32905063 |
| Molecular Formula | C24H21N3O5S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | (4-methylsulfanyl-3-nitrophenyl)-[2-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]phenyl]methanone |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)N2CCN(C(=O)c3cccs3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N3O5S2/c1-33-20-9-8-16(15-19(20)27(31)32)22(28)17-5-2-3-6-18(17)23(29)25-10-12-26(13-11-25)24(30)21-7-4-14-34-21/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | WUYFKRAOOIRUQX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|