C23H16N4O6S — CID 4821422
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate (PubChem CID 4821422) has the molecular formula C23H16N4O6S and a molecular weight of 476.47 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 4821422 |
| Molecular Formula | C23H16N4O6S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)OCn2nnc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16N4O6S/c1-34-20-11-10-14(12-19(20)27(31)32)21(28)15-6-2-3-7-16(15)23(30)33-13-26-22(29)17-8-4-5-9-18(17)24-25-26/h2-12H,13H2,1H3 |
| InChIKey | NVYNZOHMSOCLAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 134.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|