C23H16ClN3O5S — CID 41250909
(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate (PubChem CID 41250909) has the molecular formula C23H16ClN3O5S and a molecular weight of 481.92 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate.
| Compound Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 41250909 |
| Molecular Formula | C23H16ClN3O5S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methylsulfanyl-3-nitrobenzoyl)benzoate |
| SMILES | CSc1ccc(C(=O)c2ccccc2C(=O)OCc2cn3cc(Cl)ccc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16ClN3O5S/c1-33-20-8-6-14(10-19(20)27(30)31)22(28)17-4-2-3-5-18(17)23(29)32-13-16-12-26-11-15(24)7-9-21(26)25-16/h2-12H,13H2,1H3 |
| InChIKey | OISCELUJKDYFQQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|