C22H15ClN4O5S — CID 55817839
[2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 55817839) has the molecular formula C22H15ClN4O5S and a molecular weight of 482.91 g/mol. Its IUPAC name is [2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 55817839 |
| Molecular Formula | C22H15ClN4O5S |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | Cn1cc(-c2nc(COC(=O)c3ccccc3C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cs2)cn1 |
| InChI | InChI=1S/C22H15ClN4O5S/c1-26-10-14(9-24-26)21-25-15(12-33-21)11-32-22(29)17-5-3-2-4-16(17)20(28)13-6-7-18(23)19(8-13)27(30)31/h2-10,12H,11H2,1H3 |
| InChIKey | FZZCBQMGYHAKDP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|