C19H16Cl2O3 — CID 16556463
(2,2-dichlorocyclopropyl)methyl 2-(4-methylbenzoyl)benzoate (PubChem CID 16556463) has the molecular formula C19H16Cl2O3 and a molecular weight of 363.24 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl 2-(4-methylbenzoyl)benzoate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 16556463 |
| Molecular Formula | C19H16Cl2O3 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl 2-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2O3/c1-12-6-8-13(9-7-12)17(22)15-4-2-3-5-16(15)18(23)24-11-14-10-19(14,20)21/h2-9,14H,10-11H2,1H3 |
| InChIKey | JTEVYJXYXZUBHS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|