C20H24O7 — CID 175522066
2-(oxiran-2-ylmethoxycarbonyl)benzoic acid;3-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]heptane (PubChem CID 175522066) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxycarbonyl)benzoic acid;3-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 2-(oxiran-2-ylmethoxycarbonyl)benzoic acid;3-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 175522066 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(oxiran-2-ylmethoxycarbonyl)benzoic acid;3-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]heptane |
| SMILES | C1CC2OC2CC1CC1CO1.O=C(O)c1ccccc1C(=O)OCC1CO1 |
| InChI | InChI=1S/C11H10O5.C9H14O2/c12-10(13)8-3-1-2-4-9(8)11(14)16-6-7-5-15-7;1-2-8-9(11-8)4-6(1)3-7-5-10-7/h1-4,7H,5-6H2,(H,12,13);6-9H,1-5H2 |
| InChIKey | VPWJHUYVCANZAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|