About pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate (PubChem CID 102267928) has the molecular formula C27H27NO5
and a molecular weight of 445.52 g/mol. Its IUPAC name is pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate.
Molecular Properties
| Compound Name | pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate |
| PubChem CID | 102267928 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate |
| SMILES | CCCC(C)OC(=O)c1ccc(/N=C/c2ccc(OC(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H27NO5/c1-4-5-19(2)32-26(29)21-8-12-23(13-9-21)28-18-20-6-14-25(15-7-20)33-27(30)22-10-16-24(31-3)17-11-22/h6-19H,4-5H2,1-3H3/b28-18+ |
| InChIKey | HHNFBMUBTGGHIC-MTDXEUNCSA-N |
| XLogP | 6.01 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate?
The IUPAC name of pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate (CID 102267928) is pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate.
What is the SMILES notation for pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate?
The canonical SMILES for pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate is CCCC(C)OC(=O)c1ccc(/N=C/c2ccc(OC(=O)c3ccc(OC)cc3)cc2)cc1.
What is the InChIKey of pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate?
The InChIKey is HHNFBMUBTGGHIC-MTDXEUNCSA-N. The full InChI is InChI=1S/C27H27NO5/c1-4-5-19(2)32-26(29)21-8-12-23(13-9-21)28-18-20-6-14-25(15-7-20)33-27(30)22-10-16-24(31-3)17-11-22/h6-19H,4-5H2,1-3H3/b28-18+.
What are the key properties of pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate?
pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate has a molecular weight of 445.52 g/mol, XLogP of 6.01, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate is sourced from PubChem (CID 102267928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).