C21H24FN3O2 — CID 55446331
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-2-(N-ethyl-4-fluoroanilino)acetamide (PubChem CID 55446331) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-2-(N-ethyl-4-fluoroanilino)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-2-(N-ethyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 55446331 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-2-(N-ethyl-4-fluoroanilino)acetamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)CN(CC)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H24FN3O2/c1-3-24(18-8-6-17(22)7-9-18)16-21(26)25(15-5-14-23)19-10-12-20(13-11-19)27-4-2/h6-13H,3-5,15-16H2,1-2H3 |
| InChIKey | MDLGYVGZERFNSI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |