C21H34N3O3S+ — CID 8875679
cyclopentyl-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-dimethylazanium (PubChem CID 8875679) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is cyclopentyl-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-dimethylazanium.
| Compound Name | cyclopentyl-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875679 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | cyclopentyl-[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-dimethylazanium |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C[N+](C)(C)C3CCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H34N3O3S/c1-17-9-10-20(18(2)15-17)28(26,27)23-13-11-22(12-14-23)21(25)16-24(3,4)19-7-5-6-8-19/h9-10,15,19H,5-8,11-14,16H2,1-4H3/q+1 |
| InChIKey | TUSDHGISMMIWPH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|