C21H28N3O3S+ — CID 8857020
1-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone (PubChem CID 8857020) has the molecular formula C21H28N3O3S+ and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8857020 |
| Molecular Formula | C21H28N3O3S+ |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
| SMILES | CCc1cc[n+](CC(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C21H28N3O3S/c1-4-19-7-9-22(10-8-19)16-21(25)23-11-13-24(14-12-23)28(26,27)20-6-5-17(2)15-18(20)3/h5-10,15H,4,11-14,16H2,1-3H3/q+1 |
| InChIKey | VOMDOJZMGZZKPP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|