C22H25FN2O5S — CID 4841380
4-(4-acetylphenoxy)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 4841380) has the molecular formula C22H25FN2O5S and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-acetylphenoxy)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4841380 |
| Molecular Formula | C22H25FN2O5S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-(4-acetylphenoxy)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CC(=O)c1ccc(OCCCC(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25FN2O5S/c1-17(26)18-4-8-20(9-5-18)30-16-2-3-22(27)24-12-14-25(15-13-24)31(28,29)21-10-6-19(23)7-11-21/h4-11H,2-3,12-16H2,1H3 |
| InChIKey | BIABIPPBCLOLIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|