C19H19Cl2N3O5S — CID 55403081
4-[2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]benzamide (PubChem CID 55403081) has the molecular formula C19H19Cl2N3O5S and a molecular weight of 472.35 g/mol. Its IUPAC name is 4-[2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55403081 |
| Molecular Formula | C19H19Cl2N3O5S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 4-[2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCC(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O5S/c20-16-6-5-15(11-17(16)21)30(27,28)24-9-7-23(8-10-24)18(25)12-29-14-3-1-13(2-4-14)19(22)26/h1-6,11H,7-10,12H2,(H2,22,26) |
| InChIKey | PDVCFGKWZLHZFO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |