C20H19F4NO2 — CID 112778179
1-(4-benzylpiperidin-1-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone (PubChem CID 112778179) has the molecular formula C20H19F4NO2 and a molecular weight of 381.37 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
|---|---|
| PubChem CID | 112778179 |
| Molecular Formula | C20H19F4NO2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
| SMILES | O=C(COc1c(F)c(F)cc(F)c1F)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H19F4NO2/c21-15-11-16(22)19(24)20(18(15)23)27-12-17(26)25-8-6-14(7-9-25)10-13-4-2-1-3-5-13/h1-5,11,14H,6-10,12H2 |
| InChIKey | FACQGNIZHPXWAY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|