C26H23F4NO — CID 46086933
[4-[2-(4-phenylphenyl)ethyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 46086933) has the molecular formula C26H23F4NO and a molecular weight of 441.47 g/mol. Its IUPAC name is [4-[2-(4-phenylphenyl)ethyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone.
| Compound Name | [4-[2-(4-phenylphenyl)ethyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 46086933 |
| Molecular Formula | C26H23F4NO |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [4-[2-(4-phenylphenyl)ethyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)cc(F)c1F)N1CCC(CCc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H23F4NO/c27-21-16-22(28)25(30)23(24(21)29)26(32)31-14-12-18(13-15-31)7-6-17-8-10-20(11-9-17)19-4-2-1-3-5-19/h1-5,8-11,16,18H,6-7,12-15H2 |
| InChIKey | HLXDDNVGOLUPAZ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|