C15H14FN3O3S — CID 9164013
4-(4-fluorophenyl)sulfanyl-N',N'-dimethyl-3-nitrobenzohydrazide (PubChem CID 9164013) has the molecular formula C15H14FN3O3S and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-N',N'-dimethyl-3-nitrobenzohydrazide.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-N',N'-dimethyl-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9164013 |
| Molecular Formula | C15H14FN3O3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-N',N'-dimethyl-3-nitrobenzohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(Sc2ccc(F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14FN3O3S/c1-18(2)17-15(20)10-3-8-14(13(9-10)19(21)22)23-12-6-4-11(16)5-7-12/h3-9H,1-2H3,(H,17,20) |
| InChIKey | RTSXGZBQUGQFID-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|