C16H13ClN2O3S — CID 9165629
4-(4-chlorophenyl)sulfanyl-N-cyclopropyl-3-nitrobenzamide (PubChem CID 9165629) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-cyclopropyl-3-nitrobenzamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-cyclopropyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 9165629 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-cyclopropyl-3-nitrobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13ClN2O3S/c17-11-2-6-13(7-3-11)23-15-8-1-10(9-14(15)19(21)22)16(20)18-12-4-5-12/h1-3,6-9,12H,4-5H2,(H,18,20) |
| InChIKey | GZCYIXJRNBZBSY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|