C17H22N2O5S — CID 7752902
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 7752902) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7752902 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N2O5S/c1-12(2)17(3,11-18)19-15(20)9-24-16(21)14-7-5-13(6-8-14)10-25(4,22)23/h5-8,12H,9-10H2,1-4H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | YRTHZWMOJZXEOT-KRWDZBQOSA-N |
| XLogP | 1.44 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |