C20H27N3O4 — CID 7768793
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate (PubChem CID 7768793) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768793 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H27N3O4/c1-15(2)20(3,14-21)22-18(24)13-27-19(25)17-6-4-16(5-7-17)12-23-8-10-26-11-9-23/h4-7,15H,8-13H2,1-3H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | MMMBTEFCUOVRJN-FQEVSTJZSA-N |
| XLogP | 1.73 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |