C19H28N2O4 — CID 7768690
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate (PubChem CID 7768690) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768690 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(morpholin-4-ylmethyl)benzoate |
| SMILES | CC(C)[C@@H](C)NC(=O)COC(=O)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-14(2)15(3)20-18(22)13-25-19(23)17-6-4-16(5-7-17)12-21-8-10-24-11-9-21/h4-7,14-15H,8-13H2,1-3H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | WHBSXRIBBYTYQA-OAHLLOKOSA-N |
| XLogP | 1.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |