C19H20ClNO5S2 — CID 29381832
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 29381832) has the molecular formula C19H20ClNO5S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 29381832 |
| Molecular Formula | C19H20ClNO5S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)OCC(=O)c3ccc(Cl)s3)cc2)CC1 |
| InChI | InChI=1S/C19H20ClNO5S2/c1-13-8-10-21(11-9-13)28(24,25)15-4-2-14(3-5-15)19(23)26-12-16(22)17-6-7-18(20)27-17/h2-7,13H,8-12H2,1H3 |
| InChIKey | ZCNWJTDOZWUQSO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |