C25H25NO6S — CID 16535076
[2-(2-methoxyphenyl)-2-oxoethyl] 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate (PubChem CID 16535076) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 16535076 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)OCC(=O)c2ccccc2OC)ccc1C |
| InChI | InChI=1S/C25H25NO6S/c1-4-26(20-10-6-5-7-11-20)33(29,30)24-16-19(15-14-18(24)2)25(28)32-17-22(27)21-12-8-9-13-23(21)31-3/h5-16H,4,17H2,1-3H3 |
| InChIKey | CYKKQDLICBKPKV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |