C23H21Cl2NO4S — CID 2385677
(2,4-dichlorophenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate (PubChem CID 2385677) has the molecular formula C23H21Cl2NO4S and a molecular weight of 478.40 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | (2,4-dichlorophenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 2385677 |
| Molecular Formula | C23H21Cl2NO4S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)OCc2ccc(Cl)cc2Cl)ccc1C |
| InChI | InChI=1S/C23H21Cl2NO4S/c1-3-26(20-7-5-4-6-8-20)31(28,29)22-13-17(10-9-16(22)2)23(27)30-15-18-11-12-19(24)14-21(18)25/h4-14H,3,15H2,1-2H3 |
| InChIKey | UUSPJHAGNCGBJU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |