C26H27NO6S — CID 2609242
(5-acetyl-2-methoxyphenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate (PubChem CID 2609242) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 2609242 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 3-[ethyl(phenyl)sulfamoyl]-4-methylbenzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)OCc2cc(C(C)=O)ccc2OC)ccc1C |
| InChI | InChI=1S/C26H27NO6S/c1-5-27(23-9-7-6-8-10-23)34(30,31)25-16-21(12-11-18(25)2)26(29)33-17-22-15-20(19(3)28)13-14-24(22)32-4/h6-16H,5,17H2,1-4H3 |
| InChIKey | DYNRMLNHFKNNNZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |