C23H23BrN2O4S — CID 110826037
4-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]amino]-N-ethyl-N-phenylbenzenesulfonamide (PubChem CID 110826037) has the molecular formula C23H23BrN2O4S and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]amino]-N-ethyl-N-phenylbenzenesulfonamide.
| Compound Name | 4-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]amino]-N-ethyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 110826037 |
| Molecular Formula | C23H23BrN2O4S |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 4-[[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl]amino]-N-ethyl-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(NCC(=O)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H23BrN2O4S/c1-3-26(19-7-5-4-6-8-19)31(28,29)20-12-10-18(11-13-20)25-16-22(27)17-9-14-23(30-2)21(24)15-17/h4-15,25H,3,16H2,1-2H3 |
| InChIKey | FXHIGMSHLSVNLV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |