C30H48O8 — CID 160656941
methane;4-methoxybutyl 4-acetylbenzoate;2-methoxyethyl 4-acetylbenzoate (PubChem CID 160656941) has the molecular formula C30H48O8 and a molecular weight of 536.71 g/mol. Its IUPAC name is methane;4-methoxybutyl 4-acetylbenzoate;2-methoxyethyl 4-acetylbenzoate.
| Compound Name | methane;4-methoxybutyl 4-acetylbenzoate;2-methoxyethyl 4-acetylbenzoate |
|---|---|
| PubChem CID | 160656941 |
| Molecular Formula | C30H48O8 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | methane;4-methoxybutyl 4-acetylbenzoate;2-methoxyethyl 4-acetylbenzoate |
| SMILES | C.C.C.C.COCCCCOC(=O)c1ccc(C(C)=O)cc1.COCCOC(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C14H18O4.C12H14O4.4CH4/c1-11(15)12-5-7-13(8-6-12)14(16)18-10-4-3-9-17-2;1-9(13)10-3-5-11(6-4-10)12(14)16-8-7-15-2;;;;/h5-8H,3-4,9-10H2,1-2H3;3-6H,7-8H2,1-2H3;4*1H4 |
| InChIKey | RLECJPHUVMYCAX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|