About 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate
4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate (PubChem CID 167610657) has the molecular formula C23H24O6
and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate.
Molecular Properties
| Compound Name | 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate |
| PubChem CID | 167610657 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate |
| SMILES | COCCCCOC(=O)c1ccc(C(=O)CC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H24O6/c1-16(24)17-5-7-18(8-6-17)21(25)15-22(26)19-9-11-20(12-10-19)23(27)29-14-4-3-13-28-2/h5-12H,3-4,13-15H2,1-2H3 |
| InChIKey | KZORCEBWRMPCHQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate?
The IUPAC name of 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate (CID 167610657) is 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate.
What is the SMILES notation for 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate?
The canonical SMILES for 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate is COCCCCOC(=O)c1ccc(C(=O)CC(=O)c2ccc(C(C)=O)cc2)cc1.
What is the InChIKey of 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate?
The InChIKey is KZORCEBWRMPCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O6/c1-16(24)17-5-7-18(8-6-17)21(25)15-22(26)19-9-11-20(12-10-19)23(27)29-14-4-3-13-28-2/h5-12H,3-4,13-15H2,1-2H3.
What are the key properties of 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate?
4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate has a molecular weight of 396.44 g/mol, XLogP of 3.93, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutyl 4-[3-(4-acetylphenyl)-3-oxopropanoyl]benzoate is sourced from PubChem (CID 167610657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).