C26H31O12P — CID 22948301
4-O-[2-[2-(4-acetylbenzoyl)oxyethoxy-ethoxyphosphoryl]oxyethyl] 1-O-(2-methoxyethyl) benzene-1,4-dicarboxylate (PubChem CID 22948301) has the molecular formula C26H31O12P and a molecular weight of 566.50 g/mol. Its IUPAC name is 4-O-[2-[2-(4-acetylbenzoyl)oxyethoxy-ethoxyphosphoryl]oxyethyl] 1-O-(2-methoxyethyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[2-(4-acetylbenzoyl)oxyethoxy-ethoxyphosphoryl]oxyethyl] 1-O-(2-methoxyethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22948301 |
| Molecular Formula | C26H31O12P |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 4-O-[2-[2-(4-acetylbenzoyl)oxyethoxy-ethoxyphosphoryl]oxyethyl] 1-O-(2-methoxyethyl) benzene-1,4-dicarboxylate |
| SMILES | CCOP(=O)(OCCOC(=O)c1ccc(C(C)=O)cc1)OCCOC(=O)c1ccc(C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C26H31O12P/c1-4-36-39(31,37-17-15-34-25(29)21-7-5-20(6-8-21)19(2)27)38-18-16-35-26(30)23-11-9-22(10-12-23)24(28)33-14-13-32-3/h5-12H,4,13-18H2,1-3H3 |
| InChIKey | REGQQMOMZLKHJR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|