C17H25NO3 — CID 143001988
4-methoxy-3,5-dimethyl-N-[(3R)-5-methyl-2-oxohexan-3-yl]benzamide (PubChem CID 143001988) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-N-[(3R)-5-methyl-2-oxohexan-3-yl]benzamide.
| Compound Name | 4-methoxy-3,5-dimethyl-N-[(3R)-5-methyl-2-oxohexan-3-yl]benzamide |
|---|---|
| PubChem CID | 143001988 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-N-[(3R)-5-methyl-2-oxohexan-3-yl]benzamide |
| SMILES | COc1c(C)cc(C(=O)N[C@H](CC(C)C)C(C)=O)cc1C |
| InChI | InChI=1S/C17H25NO3/c1-10(2)7-15(13(5)19)18-17(20)14-8-11(3)16(21-6)12(4)9-14/h8-10,15H,7H2,1-6H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | HVXAKNZSBXTYDD-OAHLLOKOSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |