C13H13N3O4S — CID 107829741
(2R)-5-amino-2-(1,3-benzothiazole-6-carbonylamino)-5-oxopentanoic acid (PubChem CID 107829741) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is (2R)-5-amino-2-(1,3-benzothiazole-6-carbonylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(1,3-benzothiazole-6-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829741 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (2R)-5-amino-2-(1,3-benzothiazole-6-carbonylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)c1ccc2ncsc2c1)C(=O)O |
| InChI | InChI=1S/C13H13N3O4S/c14-11(17)4-3-9(13(19)20)16-12(18)7-1-2-8-10(5-7)21-6-15-8/h1-2,5-6,9H,3-4H2,(H2,14,17)(H,16,18)(H,19,20)/t9-/m1/s1 |
| InChIKey | FEPSFKNXOLJJMK-SECBINFHSA-N |
| XLogP | 0.74 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |