C34H42N2O6PS+ — CID 159939954
2-[5-[(4-amino-5-oxo-5-propoxypentanoyl)amino]-4-oxo-6-sulfanylhexanoyl]oxyethyl-triphenylphosphanium (PubChem CID 159939954) has the molecular formula C34H42N2O6PS+ and a molecular weight of 637.76 g/mol. Its IUPAC name is 2-[5-[(4-amino-5-oxo-5-propoxypentanoyl)amino]-4-oxo-6-sulfanylhexanoyl]oxyethyl-triphenylphosphanium.
| Compound Name | 2-[5-[(4-amino-5-oxo-5-propoxypentanoyl)amino]-4-oxo-6-sulfanylhexanoyl]oxyethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 159939954 |
| Molecular Formula | C34H42N2O6PS+ |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 2-[5-[(4-amino-5-oxo-5-propoxypentanoyl)amino]-4-oxo-6-sulfanylhexanoyl]oxyethyl-triphenylphosphanium |
| SMILES | CCCOC(=O)C(N)CCC(=O)NC(CS)C(=O)CCC(=O)OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H41N2O6PS/c1-2-22-42-34(40)29(35)18-20-32(38)36-30(25-44)31(37)19-21-33(39)41-23-24-43(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-17,29-30H,2,18-25,35H2,1H3,(H-,36,38,44)/p+1 |
| InChIKey | XRYJYADTXSPGPY-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|