C23H28N2O6 — CID 174940373
benzyl 4-amino-5-[(3-hydroxy-1-oxo-1-phenylmethoxybutan-2-yl)amino]-5-oxopentanoate (PubChem CID 174940373) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is benzyl 4-amino-5-[(3-hydroxy-1-oxo-1-phenylmethoxybutan-2-yl)amino]-5-oxopentanoate.
| Compound Name | benzyl 4-amino-5-[(3-hydroxy-1-oxo-1-phenylmethoxybutan-2-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 174940373 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | benzyl 4-amino-5-[(3-hydroxy-1-oxo-1-phenylmethoxybutan-2-yl)amino]-5-oxopentanoate |
| SMILES | CC(O)C(NC(=O)C(N)CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O6/c1-16(26)21(23(29)31-15-18-10-6-3-7-11-18)25-22(28)19(24)12-13-20(27)30-14-17-8-4-2-5-9-17/h2-11,16,19,21,26H,12-15,24H2,1H3,(H,25,28) |
| InChIKey | AEYALNBOHQWMIC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |