C25H35N3O8 — CID 101061388
diethyl (2R,3R)-1-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]aziridine-2,3-dicarboxylate (PubChem CID 101061388) has the molecular formula C25H35N3O8 and a molecular weight of 505.57 g/mol. Its IUPAC name is diethyl (2R,3R)-1-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]aziridine-2,3-dicarboxylate.
| Compound Name | diethyl (2R,3R)-1-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101061388 |
| Molecular Formula | C25H35N3O8 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | diethyl (2R,3R)-1-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]aziridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C(=O)OCC)N1C(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35N3O8/c1-7-34-22(31)18-19(23(32)35-8-2)28(18)21(30)15(3)26-20(29)17(14-16-12-10-9-11-13-16)27-24(33)36-25(4,5)6/h9-13,15,17-19H,7-8,14H2,1-6H3,(H,26,29)(H,27,33)/t15-,17-,18+,19+/m0/s1 |
| InChIKey | OAEFMOCHBJXDDP-GDAAHCPNSA-N |
| XLogP | 1.33 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|