C19H24N2O5 — CID 15126529
ethyl (2S)-2-[(2-nitro-2-prop-2-enylpent-4-enoyl)amino]-3-phenylpropanoate (PubChem CID 15126529) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-nitro-2-prop-2-enylpent-4-enoyl)amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[(2-nitro-2-prop-2-enylpent-4-enoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 15126529 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl (2S)-2-[(2-nitro-2-prop-2-enylpent-4-enoyl)amino]-3-phenylpropanoate |
| SMILES | C=CCC(CC=C)(C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC)[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N2O5/c1-4-12-19(13-5-2,21(24)25)18(23)20-16(17(22)26-6-3)14-15-10-8-7-9-11-15/h4-5,7-11,16H,1-2,6,12-14H2,3H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | ZRESSUIHDAOQKZ-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|