C21H14ClN5O3S — CID 108751664
2-(2-chlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108751664) has the molecular formula C21H14ClN5O3S and a molecular weight of 451.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108751664 |
| Molecular Formula | C21H14ClN5O3S |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1sc2nc(NC(=O)c3ccc4c(c3)C(=O)N(c3ccccc3Cl)C4=O)nn2c1C |
| InChI | InChI=1S/C21H14ClN5O3S/c1-10-11(2)31-21-24-20(25-27(10)21)23-17(28)12-7-8-13-14(9-12)19(30)26(18(13)29)16-6-4-3-5-15(16)22/h3-9H,1-2H3,(H,23,25,28) |
| InChIKey | WKSUHZMFSSGYOU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|