C21H18N2O4 — CID 9414010
[2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 9414010) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9414010 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-[4-(4-methylphenoxy)anilino]-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)COC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c1-15-4-8-18(9-5-15)27-19-10-6-17(7-11-19)23-20(24)14-26-21(25)16-3-2-12-22-13-16/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | ZFPCRDIGAAQOAQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |