C18H16BrClN2O7 — CID 35777615
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 35777615) has the molecular formula C18H16BrClN2O7 and a molecular weight of 487.69 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 35777615 |
| Molecular Formula | C18H16BrClN2O7 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Br)cc(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1OC |
| InChI | InChI=1S/C18H16BrClN2O7/c1-3-28-17-12(19)6-10(7-15(17)27-2)18(24)29-9-16(23)21-14-8-11(22(25)26)4-5-13(14)20/h4-8H,3,9H2,1-2H3,(H,21,23) |
| InChIKey | VPOJDFRKALCERG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|