About [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate
[2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 2359880) has the molecular formula C18H17BrO3
and a molecular weight of 361.24 g/mol. Its IUPAC name is [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate.
Molecular Properties
| Compound Name | [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate |
| PubChem CID | 2359880 |
| Molecular Formula | C18H17BrO3 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)c1ccccc1Br)c1ccccc1 |
| InChI | InChI=1S/C18H17BrO3/c1-2-14(13-8-4-3-5-9-13)18(21)22-12-17(20)15-10-6-7-11-16(15)19/h3-11,14H,2,12H2,1H3/t14-/m0/s1 |
| InChIKey | SSWCSHZFUKAUFC-AWEZNQCLSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The IUPAC name of [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate (CID 2359880) is [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate.
What is the SMILES notation for [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The canonical SMILES for [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate is CC[C@H](C(=O)OCC(=O)c1ccccc1Br)c1ccccc1.
What is the InChIKey of [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The InChIKey is SSWCSHZFUKAUFC-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H17BrO3/c1-2-14(13-8-4-3-5-9-13)18(21)22-12-17(20)15-10-6-7-11-16(15)19/h3-11,14H,2,12H2,1H3/t14-/m0/s1.
What are the key properties of [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
[2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate has a molecular weight of 361.24 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate is sourced from PubChem (CID 2359880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).