C21H23NO6 — CID 7233328
ethyl 4-[[2-[(2S)-2-phenoxybutanoyl]oxyacetyl]amino]benzoate (PubChem CID 7233328) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 4-[[2-[(2S)-2-phenoxybutanoyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2S)-2-phenoxybutanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7233328 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl 4-[[2-[(2S)-2-phenoxybutanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)[C@H](CC)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-3-18(28-17-8-6-5-7-9-17)21(25)27-14-19(23)22-16-12-10-15(11-13-16)20(24)26-4-2/h5-13,18H,3-4,14H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | SINBJRIFKWLTME-SFHVURJKSA-N |
| XLogP | 3.20 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |