C22H26N2O5 — CID 7229814
[2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenoxybutanoate (PubChem CID 7229814) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenoxybutanoate.
| Compound Name | [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7229814 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (2S)-2-phenoxybutanoate |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)OCC(=O)N(C)CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-4-19(29-18-8-6-5-7-9-18)22(27)28-15-21(26)24(3)14-20(25)23-17-12-10-16(2)11-13-17/h5-13,19H,4,14-15H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | BKTGTCICAUHONZ-IBGZPJMESA-N |
| XLogP | 2.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |