C20H19FN2O5 — CID 9200314
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 9200314) has the molecular formula C20H19FN2O5 and a molecular weight of 386.38 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 9200314 |
| Molecular Formula | C20H19FN2O5 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)CCC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN2O5/c1-22-20(27)14-3-2-4-16(11-14)23-18(25)12-28-19(26)10-9-17(24)13-5-7-15(21)8-6-13/h2-8,11H,9-10,12H2,1H3,(H,22,27)(H,23,25) |
| InChIKey | XENMFJYJMKBRSM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |