C19H15ClN4O6S — CID 33225955
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate (PubChem CID 33225955) has the molecular formula C19H15ClN4O6S and a molecular weight of 462.87 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 33225955 |
| Molecular Formula | C19H15ClN4O6S |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
| SMILES | Cc1noc(CSc2ccccc2C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C19H15ClN4O6S/c1-11-21-18(30-23-11)10-31-16-5-3-2-4-13(16)19(26)29-9-17(25)22-15-8-12(24(27)28)6-7-14(15)20/h2-8H,9-10H2,1H3,(H,22,25) |
| InChIKey | MFFFJVZHEJNRBC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|