C17H22ClN3O2 — CID 119515831
N-(6-amino-3-pyridinyl)-2-(2-tert-butylphenoxy)acetamide;hydrochloride (PubChem CID 119515831) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-(2-tert-butylphenoxy)acetamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-2-(2-tert-butylphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119515831 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-(2-tert-butylphenoxy)acetamide;hydrochloride |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C17H21N3O2.ClH/c1-17(2,3)13-6-4-5-7-14(13)22-11-16(21)20-12-8-9-15(18)19-10-12;/h4-10H,11H2,1-3H3,(H2,18,19)(H,20,21);1H |
| InChIKey | GPOZXYNIJGETDT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |