C20H23NO5S2 — CID 24536657
2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 24536657) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24536657 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccccc2C2SCCS2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23NO5S2/c1-23-16-10-13(11-17(24-2)19(16)25-3)21-18(22)12-26-15-7-5-4-6-14(15)20-27-8-9-28-20/h4-7,10-11,20H,8-9,12H2,1-3H3,(H,21,22) |
| InChIKey | ZQUIFHOUNYVFGW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |