C17H16ClNO2S2 — CID 9032046
N-(2-chlorophenyl)-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide (PubChem CID 9032046) has the molecular formula C17H16ClNO2S2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 9032046 |
| Molecular Formula | C17H16ClNO2S2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1C1SCCS1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H16ClNO2S2/c18-13-6-2-3-7-14(13)19-16(20)11-21-15-8-4-1-5-12(15)17-22-9-10-23-17/h1-8,17H,9-11H2,(H,19,20) |
| InChIKey | XARGFPJGRJMKDS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |