C14H17NO2S2 — CID 9207552
2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-prop-2-enylacetamide (PubChem CID 9207552) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9207552 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1ccccc1C1SCCS1 |
| InChI | InChI=1S/C14H17NO2S2/c1-2-7-15-13(16)10-17-12-6-4-3-5-11(12)14-18-8-9-19-14/h2-6,14H,1,7-10H2,(H,15,16) |
| InChIKey | PUTHYRBZWHFXOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|